CAS 566-27-8: 7β-Hydroxycholesterol
Description:7β-Hydroxycholesterol is a sterol compound that plays a significant role in cholesterol metabolism and is a precursor in the biosynthesis of various steroid hormones. It is characterized by the presence of a hydroxyl group at the 7β position of the cholesterol molecule, which influences its biological activity and solubility. This compound is typically found in biological membranes and is involved in cellular signaling pathways. It can also serve as a marker for certain physiological and pathological conditions, particularly in the context of cardiovascular diseases and neurodegenerative disorders. 7β-Hydroxycholesterol is known to exhibit both pro-inflammatory and cytotoxic effects, which can impact cell viability and function. Its presence in the body can be indicative of altered cholesterol metabolism, and it is often studied in the context of atherosclerosis and other lipid-related disorders. As a chemical entity, it has a specific molecular structure that contributes to its reactivity and interactions with other biomolecules.
Formula:C27H46O2
InChI:InChI=1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h16-18,20-25,28-29H,6-15H2,1-5H3/t18-,20+,21-,22+,23+,24+,25+,26+,27-/m1/s1
InChI key:InChIKey=OYXZMSRRJOYLLO-KGZHIOMZSA-N
SMILES:OC1C=C2CC(O)CCC2(C)C3CCC4(C)C(CCC4C13)C(C)CCCC(C)C
- Synonyms:
- (3β,7β)-Cholest-5-ene-3,7-diol
- Δ5-Cholestene-3β,7β-diol
- 7β-Hydroxycholesterol
- Cholest-5-ene-3β,7β-diol
- Cholest-5-ene-3,7-diol, (3β,7β)-
