CAS 566-76-7: 16α-Hydroxyestrone
Description:16α-Hydroxyestrone is a naturally occurring estrogen and a metabolite of estrone, classified under the category of steroid hormones. Its chemical structure features a hydroxyl group (-OH) at the 16α position of the estrone backbone, which contributes to its biological activity. This compound is primarily involved in the metabolism of estrogens and has been studied for its potential role in various physiological processes, including reproductive health and bone density regulation. It exhibits estrogenic activity, influencing the growth and function of estrogen-sensitive tissues. Additionally, 16α-Hydroxyestrone has been investigated for its implications in hormone-related cancers, particularly breast cancer, due to its estrogenic effects. The substance is typically found in low concentrations in human tissues and biological fluids, and its levels can be influenced by factors such as age, hormonal status, and environmental exposures. As a chemical entity, it is characterized by its specific molecular formula and weight, and it is often analyzed in research settings to understand its pharmacological and toxicological properties.
Formula:C18H22O3
InChI:InChI=1S/C18H22O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-16,19-20H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,18+/m1/s1
InChI key:InChIKey=WPOCIZJTELRQMF-QFXBJFAPSA-N
SMILES:O=C1C(O)CC2C3CCC4=CC(O)=CC=C4C3CCC12C
- Synonyms:
- 3,16α-Dihydroxy-1,3,5(10)-estratrien-17-one
- 16α-Hydroxyestrone
- Estra-1,3,5(10)-trien-17-one, 3,16-dihydroxy-, (16α)-
- (16α)-3,16-Dihydroxyestra-1,3,5(10)-trien-17-one
- Estra-1,3,5(10)-trien-17-one, 3,16α-dihydroxy-
![1,3,5[10]-ESTRATRIENE-3,16α-DIOL-17-ONE](https://static.cymitquimica.com/products/IN/thumb/DA00EBMG.jpg)
