CAS 566-77-8
:(3β,20S)-3-Hydroxypregn-5-ene-20-carboxylic acid
Description:
(3β,20S)-3-Hydroxypregn-5-ene-20-carboxylic acid, also known as pregnenolone-20-carboxylic acid, is a steroid compound characterized by its hydroxyl and carboxylic acid functional groups. It is derived from pregnenolone, a precursor in the biosynthesis of various steroid hormones. The presence of the hydroxyl group at the 3β position and the carboxylic acid at the 20 position contributes to its unique chemical properties, including its solubility in polar solvents and potential reactivity in biochemical pathways. This compound plays a role in steroid metabolism and may influence various physiological processes, including hormone synthesis and regulation. Its stereochemistry, particularly the 20S configuration, is crucial for its biological activity. As a chemical entity, it is of interest in pharmacological research, particularly in studies related to neurosteroids and their effects on the central nervous system. The CAS number 566-77-8 uniquely identifies this compound in chemical databases, facilitating its study and application in scientific research.
Formula:C22H34O3
InChI:InChI=1S/C22H34O3/c1-13(20(24)25)17-6-7-18-16-5-4-14-12-15(23)8-10-21(14,2)19(16)9-11-22(17,18)3/h4,13,15-19,23H,5-12H2,1-3H3,(H,24,25)/t13-,15-,16-,17+,18-,19-,21-,22+/m0/s1
InChI key:InChIKey=NPBNRBWMDNZEBN-ZLWIHRGSSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)C(=CC3)C[C@@H](O)CC4)(CC1)[H])[H])(CC[C@@]2([C@@H](C(O)=O)C)[H])[H]
Synonyms:- 3β-Hydroxy-5-pregnene-20α-carboxylic acid
- Fernholz acid
- Pregn-5-ene-20α-carboxylic acid, 3β-hydroxy-
- (3β,20S)-3-Hydroxypregn-5-ene-20-carboxylic acid
- Pregn-5-ene-20-carboxylic acid, 3-hydroxy-, (3β,20S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Hydroxybisnorcholenic acid
CAS:Controlled Product<p>Hydroxybisnorcholenic acid is a sterol that is present in high concentrations in the skin and other tissues. It has been shown to have biological properties, such as meiosis, and to be involved in the regulation of ion transport. Hydroxybisnorcholenic acid is also one of the major components of the saponified product of cholesterol. The molecule is a target tissue for control levels of biochemical analysis and modulation by hormones. Hydroxybisnorcholenic acid can be converted into aminosterol, which then undergoes additional conversion to cholesterol.</p>Formula:C22H34O3Purity:Min. 95%Color and Shape:PowderMolecular weight:346.50 g/mol
