CAS 5660-45-7

2,2':5',2'':5'',2''':5''',2''''-quinquethiophene

Description:

2,2':5',2'':5'',2''':5''',2''''-quinquethiophene, commonly referred to as quinquethiophene, is a polycyclic aromatic compound characterized by its unique structure comprising five thiophene rings linked in a linear arrangement. This compound exhibits notable electronic properties, making it of interest in organic electronics, particularly in organic semiconductors and photovoltaic applications. Quinquethiophene is known for its high charge carrier mobility and stability, which are essential for efficient device performance. The presence of sulfur atoms in the thiophene rings contributes to its distinct electronic characteristics, including a relatively low bandgap, allowing for effective light absorption. Additionally, quinquethiophene can exhibit strong π-π stacking interactions, enhancing its performance in solid-state applications. Its solubility and processability can vary depending on the substituents attached to the thiophene rings, influencing its application in various organic materials. Overall, quinquethiophene is a significant compound in the field of organic chemistry and materials science, particularly for its potential in developing advanced electronic devices.

Formula: C₂₀H₁₂S₅

InChI: InChI=1/C20H12S5/c1-3-13(21-11-1)15-5-7-17(23-15)19-9-10-20(25-19)18-8-6-16(24-18)14-4-2-12-22-14/h1-12H

SMILES: c1cc(c2ccc(c3ccc(c4ccc(c5cccs5)s4)s3)s2)sc1

Synonyms:

• α-Quinquethiophene
• 2,2':5',2'':5'',2''':5''',2''''-Quinquethiophene

α-Quinquethiophene

CAS: 5660-45-7

Formula: C₂₀H₁₂S₅

Purity: >98.0%(HPLC)

Color and Shape: Light yellow to Brown powder to crystal

Molecular weight: 412.62

Ref: 3B-Q0079

2,2':5',2'':5'',2''':5''',2''''-Quinquethiophene

CAS: 5660-45-7

Formula: C₂₀H₁₂S₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 412.6343

Ref: IN-DA003F8Z