CAS 5661-55-2
:4-phenylazetidin-2-one
Description:
4-Phenylazetidin-2-one, also known as a derivative of azetidine, is a cyclic amide characterized by a four-membered ring structure containing a nitrogen atom. This compound features a phenyl group attached to the azetidine ring, which contributes to its unique chemical properties. It typically exhibits a solid-state at room temperature and is soluble in organic solvents, reflecting its moderate polarity. The presence of the carbonyl group (C=O) in the azetidinone structure imparts reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the compound may exhibit biological activity, which can be explored for pharmaceutical applications. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use. Overall, 4-phenylazetidin-2-one represents a versatile compound with applications in organic synthesis and medicinal chemistry.
Formula:C9H9NO
InChI:InChI=1/C9H9NO/c11-9-6-8(10-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,10,11)
SMILES:c1ccc(cc1)C1CC(=N1)O
Synonyms:- 2-Azetidinone, 4-Phenyl-
- 4-Phenylazetidin-2-on
- 4-Phenyl-2-azetidinone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Phenylazetidin-2-one
CAS:<p>4-Phenylazetidin-2-one is a potent antitumor agent that inhibits serine protease and has been shown to have anticancer activity. It is also an enzyme inhibitor that can be used as a reagent for the preparation of enzyme preparations and assays. 4-Phenylazetidin-2-one has been shown to inhibit the serine proteases chymotrypsin and trypsin, which are involved in protein digestion. It also inhibits β-amino acid aminopeptidase, which is involved in protein synthesis. 4-Phenylazetidin-2-one is useful as a reagent for the isolation of β-amino acid peptides from natural sources such as plants or animals. This compound has been shown to be effective against cancer cells due to its ability to inhibit β-amino acid aminopeptidase, which prevents the production of proteins vital for cell</p>Formula:C9H9NOPurity:Min. 95%Molecular weight:147.17 g/mol
