CAS 56611-54-2
:3-cyclohexyl-1-methyl-6-(methylamino)-1,3,5-triazine-2,4(1H,3H)-dione
Description:
3-Cyclohexyl-1-methyl-6-(methylamino)-1,3,5-triazine-2,4(1H,3H)-dione, with CAS number 56611-54-2, is a chemical compound that belongs to the class of triazine derivatives. This substance features a triazine ring, which is a six-membered heterocyclic structure containing three nitrogen atoms and three carbon atoms. The presence of cyclohexyl and methylamino groups contributes to its unique properties, potentially influencing its solubility, reactivity, and biological activity. The compound is characterized by its dione functional groups, which can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. It may exhibit applications in agricultural chemistry, particularly as a herbicide or pesticide, due to its structural similarity to other biologically active triazine compounds. Additionally, the presence of the methylamino group may enhance its interaction with biological systems. As with many organic compounds, its stability, reactivity, and potential toxicity would depend on environmental conditions and specific functional group interactions.
Formula:C11H18N4O2
InChI:InChI=1/C11H18N4O2/c1-12-9-13-10(16)15(11(17)14(9)2)8-6-4-3-5-7-8/h8H,3-7H2,1-2H3,(H,12,13,16)
SMILES:CN=c1nc(n(C2CCCCC2)c(=O)n1C)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Desmethyl Hexazinone
CAS:Controlled ProductFormula:C11H18N4O2Color and Shape:NeatMolecular weight:238.29Hexazinone metabolite B
CAS:<p>Hexazinone metabolite B is a chemical byproduct of the breakdown of Hexazinone, which is an herbicide. This metabolite emerges from an extensive metabolic pathway in plants, fungi, and soil microorganisms as they degrade the parent compound. Its mode of action involves interacting with plant processes, potentially affecting growth and development, as it may influence photosynthetic pathways or other vital physiological functions.</p>Formula:C11H18N4O2Purity:Min. 95%Molecular weight:238.29 g/mol


