CAS 56614-75-6
:5,5-dimethyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid
Description:
5,5-Dimethyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid is a heterocyclic compound characterized by its thiazolidine ring, which contains both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of two methyl groups at the 5-position and a phenyl group at the 2-position enhances its steric properties and may influence its biological activity. The thiazolidine structure is known for its role in various biochemical processes, and derivatives of this compound have been studied for their potential therapeutic applications, particularly in the field of medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its molecular structure allows for potential interactions with biological targets, making it of interest in drug design and development. Overall, 5,5-dimethyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid exemplifies the diverse chemistry of thiazolidine derivatives.
Formula:C12H15NO2S
InChI:InChI=1/C12H15NO2S/c1-12(2)9(11(14)15)13-10(16-12)8-6-4-3-5-7-8/h3-7,9-10,13H,1-2H3,(H,14,15)
SMILES:CC1(C)C(C(=O)O)NC(c2ccccc2)S1
Synonyms:- 5,5-Dimethyl-2-Phenyl-1,3-Thiazolane-4-Carboxylic Acid
- 5,5-Dimethyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5,5-Dimethyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid
CAS:<p>5,5-Dimethyl-2-phenyl-1,3-thiazolidine-4-carboxylic acid is a chemical compound that contains a thiazolidine ring. This compound is a chiral molecule and has been shown to have an interaction with tyrosinase, which is an enzyme involved in the production of melanin. The conformation of this molecule can be determined by x-ray diffraction studies. The reaction product is formed when 5,5-dimethyl-2-phenyl-1,3-thiazolidine 4 carboxylic acid reacts with an aldehyde.</p>Formula:C12H15NO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:237.32 g/mol
