CAS 56616-91-2

3-bromo-1-methyl-1H-1,2,4-triazole

Description:

3-Bromo-1-methyl-1H-1,2,4-triazole is a heterocyclic organic compound characterized by its triazole ring, which consists of three nitrogen atoms and two carbon atoms. The presence of a bromine atom at the 3-position and a methyl group at the 1-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It exhibits moderate stability under standard conditions but may be sensitive to strong acids or bases. 3-Bromo-1-methyl-1H-1,2,4-triazole is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities, such as antifungal and herbicidal properties. Its reactivity can be attributed to the presence of the triazole ring, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₃H₄BrN₃

InChI: InChI=1/C3H4BrN3/c1-7-2-5-3(4)6-7/h2H,1H3

SMILES: Cn1cnc(Br)n1

Synonyms:

• 1H-1,2,4-triazole, 3-bromo-1-methyl-
• 3-Bromo-1-Methyl-1,2,4-Triazole

3-BroMo-1-Methyl-1H-1,2,4-triazole

CAS: 56616-91-2

Formula: C₃H₄BrN₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 161.9880

Ref: IN-DA003IZM

3-Bromo-1-methyl-1H-1,2,4-triazole

CAS: 56616-91-2

3-Bromo-1-methyl-1H-1,2,4-triazole

Purity: 98%

Molecular weight: 161.99g/mol

Ref: 54-OR917584

3-Bromo-1-methyl-1H-1,2,4-triazole

CAS: 56616-91-2

Formula: C₃H₄BrN₃

Purity: 95%

Color and Shape: Liquid, Yellow liquid

Molecular weight: 161.99

Ref: 10-F209307