CymitQuimica logo

CAS 566169-93-5

:

6-Benzothiazolol, 2-[4-(methylamino)phenyl]-

Description:
6-Benzothiazolol, 2-[4-(methylamino)phenyl]- (CAS 566169-93-5) is a chemical compound characterized by its unique structure, which includes a benzothiazole ring fused with a phenyl group that has a methylamino substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. It may be soluble in organic solvents and exhibit moderate polarity due to the presence of the amino group. The methylamino group can influence its reactivity and interactions, making it of interest in medicinal chemistry and drug development. Compounds like this are often studied for their potential pharmacological properties, including antimicrobial or anticancer activities. Additionally, the presence of both nitrogen and sulfur in its structure may contribute to its unique chemical behavior and interactions in various chemical environments. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C14H12N2OS
InChI:InChI=1S/C14H12N2OS/c1-15-10-4-2-9(3-5-10)14-16-12-7-6-11(17)8-13(12)18-14/h2-8,15,17H,1H3
InChI key:ZQAQXZBSGZUUNL-UHFFFAOYSA-N
SMILES:CNC1=CC=C(C=C1)C2=NC3=C(S2)C=C(C=C3)O
Synonyms:
  • 6-OH-BTA-1 (free base)
  • 2-[4'-(Methylamino)phenyl]-6-hydroxybenzothiazole
  • 6-Oh-Bta-1
Found 6 products.