CAS 56617-66-4
:(1R,3S,11bR)-1,3-dihydroxy-11b-methyl-1,2,3,7,8,11b-hexahydrocyclopenta[7,8]phenanthro[10,1-bc]furan-6,9-dione
Description:
The chemical substance with the name "(1R,3S,11bR)-1,3-dihydroxy-11b-methyl-1,2,3,7,8,11b-hexahydrocyclopenta[7,8]phenanthro[10,1-bc]furan-6,9-dione" and CAS number "56617-66-4" is a complex organic compound characterized by its unique polycyclic structure, which includes multiple fused rings and functional groups. It features two hydroxyl (-OH) groups, contributing to its potential reactivity and solubility in polar solvents. The presence of a methyl group enhances its hydrophobic characteristics, while the dione functionality indicates the presence of two carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its stereochemistry, indicated by the specific configuration at certain carbon centers, suggests that it may have distinct spatial properties that influence its interactions with biological targets. Overall, this substance represents a fascinating example of complex organic chemistry with potential applications in various fields.
Formula:C19H16O5
InChI:InChI=1/C19H16O5/c1-19-11-4-2-8-9(3-5-12(8)20)15(11)17(23)18-16(19)10(7-24-18)13(21)6-14(19)22/h2,4,7,13-14,21-22H,3,5-6H2,1H3/t13-,14+,19-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Demethoxyviridiol
CAS:Demethoxyviridiol is a mycotoxin that inhibits phosphatidylinositol 3-kinase (PI3K).Formula:C19H16O5Color and Shape:SolidMolecular weight:324.33
