
CAS 56621-94-4
:N-(2-Fluoro-5-pyrimidinyl)formamide
Description:
N-(2-Fluoro-5-pyrimidinyl)formamide is a chemical compound characterized by its pyrimidine ring structure, which includes a fluorine atom at the 2-position and a formamide functional group. This compound typically exhibits properties associated with both aromatic and amide functionalities, contributing to its potential reactivity and solubility in various solvents. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its biological activity or interaction with other molecules. N-(2-Fluoro-5-pyrimidinyl)formamide may be utilized in pharmaceutical research and development, particularly in the synthesis of biologically active compounds or as a building block in medicinal chemistry. Its molecular structure suggests it may participate in hydrogen bonding due to the amide group, which can affect its physical properties such as melting point and solubility. As with many pyrimidine derivatives, it may also exhibit specific interactions with biological targets, making it of interest in drug discovery and development.
Formula:C5H4FN3O
InChI:InChI=1S/C5H4FN3O/c6-5-7-1-4(2-8-5)9-3-10/h1-3H,(H,9,10)
InChI key:InChIKey=DPZGQQWWQDUSGK-UHFFFAOYSA-N
SMILES:N(C=O)C=1C=NC(F)=NC1
Synonyms:- N-(2-Fluoro-5-pyrimidinyl)formamide
- Formamide, N-(2-fluoro-5-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.