CAS 56632-37-2

2,3-dihydro-1H-indole-1-carbothioamide

Description:

2,3-Dihydro-1H-indole-1-carbothioamide is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a thiocarbonyl group (-C(=S)NH2) attached to the indole framework, which contributes to its reactivity and potential biological activity. The presence of the dihydro group indicates that it has two hydrogen atoms added to the indole structure, making it a saturated derivative. This compound may exhibit properties such as solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its unique structure allows for various chemical modifications, which can lead to the synthesis of derivatives with enhanced pharmacological properties. Additionally, the compound's CAS number, 56632-37-2, provides a unique identifier for regulatory and research purposes, facilitating its study in various chemical and biological contexts.

Formula: C₉H₁₀N₂S

InChI: InChI=1/C9H10N2S/c10-9(12)11-6-5-7-3-1-2-4-8(7)11/h1-4H,5-6H2,(H2,10,12)

SMILES: c1ccc2c(c1)CCN2C(=N)S

Synonyms:

• 1H-Indole-1-carbothioamide, 2,3-dihydro-
• Indoline-1-carbothioamide

indoline-1-carbothioamide

CAS: 56632-37-2

Formula: C₉H₁₀N₂S

Purity: 95.0%

Molecular weight: 178.25

Ref: 10-F308783

Aminoindolin-1-ylmethane-1-thione

CAS: 56632-37-2

Please enquire for more information about Aminoindolin-1-ylmethane-1-thione including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₁₀N₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 178.26 g/mol

Ref: 3D-FA169180