
CAS 56649-73-1
:(2R,6R,11R)-3-(3-Furanylmethyl)-1,2,3,4,5,6-hexahydro-6,11-dimethyl-2,6-methano-3-benzazocin-8-ol
Description:
The chemical substance known as "(2R,6R,11R)-3-(3-Furanylmethyl)-1,2,3,4,5,6-hexahydro-6,11-dimethyl-2,6-methano-3-benzazocin-8-ol," with the CAS number 56649-73-1, is a complex organic compound characterized by its unique bicyclic structure that incorporates both a benzazocin and a furan moiety. This compound features multiple stereocenters, contributing to its chiral nature, which can influence its biological activity and interactions. The presence of the furan ring suggests potential reactivity and applications in organic synthesis, while the hexahydro and methano groups provide structural stability. Additionally, the hydroxyl group (–OH) indicates that it may exhibit polar characteristics, potentially affecting its solubility and reactivity in various solvents. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, although specific biological activities would require further investigation. Overall, this substance exemplifies the complexity and diversity of organic molecules, particularly in the context of drug design and development.
Formula:C19H23NO2
InChI:InChI=1S/C19H23NO2/c1-13-18-9-15-3-4-16(21)10-17(15)19(13,2)6-7-20(18)11-14-5-8-22-12-14/h3-5,8,10,12-13,18,21H,6-7,9,11H2,1-2H3/t13-,18+,19+/m0/s1
InChI key:InChIKey=MSBGXQSDBDHIGV-MJXNMMHHSA-N
SMILES:C[C@]12C=3C(C[C@]([C@@H]1C)(N(CC=4C=COC4)CC2)[H])=CC=C(O)C3
Synonyms:- (-)-Mr 1452
- 2,6-Methano-3-benzazocin-8-ol, 3-(3-furanylmethyl)-1,2,3,4,5,6-hexahydro-6,11-dimethyl-, (2R,6R,11R)-
- (2R,6R,11R)-3-(3-Furanylmethyl)-1,2,3,4,5,6-hexahydro-6,11-dimethyl-2,6-methano-3-benzazocin-8-ol
- Mr 1452
- 2,6-Methano-3-benzazocin-8-ol, 3-(3-furanylmethyl)-1,2,3,4,5,6-hexahydro-6,11-dimethyl-, [2R-(2α,6α,11R*)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
MR-1452
CAS:<p>MR-1452 is a kappa opiate receptor antagonist. FOR RESEARCH USE ONLY</p>Formula:C19H23NO2Color and Shape:SolidMolecular weight:297.39
