CAS 56663-76-4
:2,2-Dimethyl-3-butynoic acid
Description:
2,2-Dimethyl-3-butynoic acid is an organic compound characterized by its alkyne functional group and carboxylic acid moiety. It features a four-carbon backbone with two methyl groups attached to the second carbon and a triple bond between the third and fourth carbons. This structure contributes to its unique reactivity and properties. The compound is typically a colorless liquid or solid, depending on temperature, and is known for its strong acidity due to the presence of the carboxylic acid group. It is soluble in organic solvents but has limited solubility in water. 2,2-Dimethyl-3-butynoic acid can participate in various chemical reactions, including nucleophilic additions and condensation reactions, making it useful in organic synthesis. Its CAS number, 56663-76-4, allows for easy identification in chemical databases. Safety precautions should be taken when handling this compound, as it may be irritant and potentially hazardous. Overall, its unique structure and properties make it a valuable compound in chemical research and applications.
Formula:C6H8O2
InChI:InChI=1S/C6H8O2/c1-4-6(2,3)5(7)8/h1H,2-3H3,(H,7,8)
InChI key:InChIKey=WCDPCILUMOPENA-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C#C)(C)C
Synonyms:- 2,2-Dimethyl-3-butynoic acid
- 2,2-Dimethyl-but-3-ynoic acid
- 2,2-Dimethylbut-3-ynoic acid
- 2,2-Dimethylbut-3-ynoicacid
- 3-Butynoic acid, 2,2-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,2-Dimethyl-3-butynoic acid
CAS:Formula:C6H8O2Purity:95%Color and Shape:LiquidMolecular weight:112.12652,2-Dimethylbut-3-ynoic acid
CAS:<p>2,2-Dimethylbut-3-ynoic acid</p>Purity:92%Molecular weight:112.13g/mol2,2-Dimethylbut-3-ynoic acid
CAS:Formula:C6H8O2Purity:95%Color and Shape:LiquidMolecular weight:112.1282,2-Dimethylbut-3-ynoic acid
CAS:<p>2,2-Dimethylbut-3-ynoic acid is an organic compound that can be synthesized from acetone. The chemical formula of this compound is C6H12O2. 2,2-Dimethylbut-3-ynoic acid has a boiling point of 157 degrees Celsius and a melting point of -87 degrees Celsius. It has the molecular weight of 136.19 g/mol and its density is 1.07 g/cm^3 at 25 degrees Celsius. This compound can be used as a precursor to other chemicals, such as butanediol or butyraldehyde, which are used in production processes for plastics and synthetic rubber.</p>Formula:C6H8O2Purity:Min. 95%Molecular weight:112.13 g/mol



