CAS 5667-70-9
:2,4-Pentanediol, 3-methyl-, 2,4-dicarbamate
Description:
2,4-Pentanediol, 3-methyl-, 2,4-dicarbamate, with the CAS number 5667-70-9, is an organic compound characterized by its dual carbamate functional groups attached to a pentanediol backbone. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is soluble in polar solvents like water and alcohols, which enhances its utility in various applications, including as a plasticizer, stabilizer, or in coatings. The presence of carbamate groups contributes to its reactivity and potential for hydrogen bonding, making it useful in polymer chemistry and as an intermediate in organic synthesis. Additionally, it may possess moderate toxicity, necessitating careful handling and adherence to safety guidelines. Its chemical structure allows for a range of interactions, making it versatile in industrial applications, particularly in the production of elastomers and other polymeric materials.
Formula:C8H16N2O4
InChI:InChI=1S/C8H16N2O4/c1-4(5(2)13-7(9)11)6(3)14-8(10)12/h4-6H,1-3H3,(H2,9,11)(H2,10,12)
InChI key:InChIKey=XAIVVICFVUFHEP-UHFFFAOYSA-N
SMILES:C(C(C(OC(N)=O)C)C)(OC(N)=O)C
Synonyms:- (4-Carbamoyloxy-3-methylpentan-2-yl) carbamate
- 1,2,3-Trimethyltrimethylenedicarbamate
- 2,4-Pentanediol, 3-methyl-, 2,4-dicarbamate
- 2,4-Pentanediol, 3-methyl-, dicarbamate
- 3-Methyl-2,4-pentanediol dicarbamate
- 3-Methylpentane-2,4-Diyl Dicarbamate
- Carbamic acid, 1,2,3-trimethyltrimethylene ester
- Pentabamat
- Pentabamate [USAN:INN]
- Unii-8871Zb4Ugc
- Pentabamate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Pentabamate
CAS:Controlled ProductPentabamate is a reconstituted pharmaceutical dosage form of alginic acid, pentaerythritol, and fatty acids. Alginic acid is a polymeric matrix that is obtained from brown seaweed and consists primarily of the polysaccharide alginate. Pentaerythritol is a sugar alcohol that functions as a plasticizer for the preparation of this drug. This drug can be used for implanting into muscle tissue to treat certain types of epilepsy. The mechanism of action for this drug is not entirely known, but it may act by binding to fatty acid receptors on muscle cells and inhibiting fat breakdown or by displacing calcium ions from muscle cells which are necessary for contraction.Formula:C8H16N2O4Purity:Min. 95%Molecular weight:204.22 g/mol

