CymitQuimica logo

CAS 56671-28-4

:

4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid

Description:
4-Oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylic acid, identified by its CAS number 56671-28-4, is a chemical compound characterized by its unique bicyclic structure that incorporates both a benzofuran moiety and a carboxylic acid functional group. This compound features a tetrahydrobenzofuran ring, which contributes to its potential biological activity and reactivity. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may serve as a precursor for further chemical modifications. Its oxo group indicates the presence of a carbonyl functionality, which can influence its reactivity and interactions with other molecules. The compound may exhibit various properties such as solubility in polar solvents, depending on the specific conditions. Additionally, due to its structural features, it may be of interest in medicinal chemistry and organic synthesis, potentially serving as a scaffold for the development of pharmaceuticals or agrochemicals. However, specific applications and biological activities would require further investigation and research.
Formula:C9H8O4
InChI:InChI=1/C9H8O4/c10-6-2-1-3-7-8(6)5(4-13-7)9(11)12/h4H,1-3H2,(H,11,12)
InChI key:FABBWECRHZNMDQ-UHFFFAOYSA-N
SMILES:C1CC(=O)c2c(coc2C1)C(=O)O
Synonyms:
  • 3-Benzofurancarboxylic Acid, 4,5,6,7-Tetrahydro-4-Oxo-
  • 4-Oxo-4,5,6,7-tetrahydrobenzofuran-3-carboxylic acid
Found 5 products.