CAS 56671-66-0

imidazo[1,5-a]pyridine-3-carbaldehyde

Description:

Imidazo[1,5-a]pyridine-3-carbaldehyde is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features an aldehyde functional group at the 3-position of the imidazo ring, making it reactive and useful in various synthetic applications. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential biological activity, including antimicrobial and anticancer properties. The presence of both nitrogen atoms in the ring structure enhances its ability to participate in coordination chemistry and interact with metal ions. Imidazo[1,5-a]pyridine-3-carbaldehyde is often utilized in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals, due to its versatile reactivity. Additionally, its unique structure allows for various functionalization reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₆N₂O

InChI: InChI=1/C8H6N2O/c11-6-8-9-5-7-3-1-2-4-10(7)8/h1-6H

SMILES: c1ccn2c(c1)cnc2C=O

Synonyms:

• Imidazo[1,5-a]pyridine-3-carboxaldehyde

Imidazo[1,5-a]pyridine-3-carboxaldehyde

CAS: 56671-66-0

Formula: C₈H₆N₂O

Purity: >98.0%(T)

Color and Shape: White to Brown powder to crystal

Molecular weight: 146.15

Ref: 3B-I0754

Imidazo[1,5-a]pyridine-3-carbaldehyde

CAS: 56671-66-0

Formula: C₈H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 146.1460

Ref: IN-DA00376Q

Imidazo[1,5-a]pyridine-3-carbaldehyde

CAS: 56671-66-0

Imidazo[1,5-a]pyridine-3-carbaldehyde

Formula: C₈H₆N₂O

Purity: 99%

Color and Shape: light green to green solid

Molecular weight: 146.15g/mol

Ref: 54-OR939831

3-Formylimidazo[1,5-a]pyridine

CAS: 56671-66-0

Formula: C₈H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 146.149

Ref: 10-F095336

Imidazo[1,5-a]pyridine-3-carboxaldehyde

CAS: 56671-66-0

Imidazo[1,5-a]pyridine-3-carboxaldehyde is a multicomponent molecule that has the potential to be used in biomolecular chemistry. It is a fluorescent compound that can be used to produce sustainable and environmentally friendly photophysical properties. Imidazo[1,5-a]pyridine-3-carboxaldehyde has been shown to have photophysical properties such as fluorescence, phosphorescence, and chemiluminescence. This molecule can also be used in the study of biomolecular chemistry and biomedical research.

Formula: C₈H₆N₂O

Purity: Min. 95%

Molecular weight: 146.15 g/mol

Ref: 3D-GCA67166