CymitQuimica logo

CAS 56672-91-4

:

2-{4-[bis(2-hydroxyethyl)amino]phenyl}ethene-1,1,2-tricarbonitrile

Description:
2-{4-[Bis(2-hydroxyethyl)amino]phenyl}ethene-1,1,2-tricarbonitrile, with the CAS number 56672-91-4, is a chemical compound characterized by its complex structure, which includes a phenyl group substituted with a bis(2-hydroxyethyl)amino moiety and a conjugated ethene system with three cyano groups. This compound typically exhibits properties associated with both organic and inorganic functionalities, including potential solubility in polar solvents due to the presence of hydroxyl groups. The cyano groups contribute to its reactivity and may facilitate interactions with various biological systems or materials. The presence of the amino groups suggests potential for hydrogen bonding and reactivity with electrophiles. Additionally, the compound may exhibit interesting optical properties due to its conjugated system, making it a candidate for applications in dyes or sensors. Overall, its unique structure imparts a range of potential applications in fields such as materials science, pharmaceuticals, and organic synthesis.
Formula:C15H14N4O2
InChI:InChI=1/C15H14N4O2/c16-9-13(10-17)15(11-18)12-1-3-14(4-2-12)19(5-7-20)6-8-21/h1-4,20-21H,5-8H2
SMILES:c1cc(ccc1C(=C(C#N)C#N)C#N)N(CCO)CCO
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.