CAS 56673-34-8

3-Bromo-6-mercaptopyridine

Description:

3-Bromo-6-mercaptopyridine is an organic compound characterized by the presence of a bromine atom and a thiol (-SH) group attached to a pyridine ring. Its molecular structure features a six-membered aromatic ring with nitrogen, which contributes to its basicity and potential for coordination with metal ions. The bromine substituent enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The thiol group imparts unique properties, such as the ability to form disulfide bonds and participate in redox reactions, which can be advantageous in biochemical applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its applications span across pharmaceuticals, agrochemicals, and materials science, particularly in the synthesis of more complex molecules. Safety considerations include handling it with care due to potential toxicity associated with brominated compounds and thiols. Proper storage and disposal methods should be followed to minimize environmental impact and health risks.

Formula: C₅H₄BrNS

InChI: InChI=1/C5H4BrNS/c6-4-1-2-5(8)7-3-4/h1-3H,(H,7,8)

SMILES: c1cc(ncc1Br)S

Synonyms:

• 5-Bromopyridine-2-thiol

3-Bromo-6-mercaptopyridine

CAS: 56673-34-8

Formula: C₅H₄BrNS

Purity: 95%

Color and Shape: Solid

Molecular weight: 190.0610

Ref: IN-DA00EG53

5-Bromopyridine-2-thiol

CAS: 56673-34-8

5-Bromopyridine-2-thiol

Purity: 95%

Molecular weight: 190.06g/mol

Ref: 54-OR902013

3-Bromo-6-mercaptopyridine

CAS: 56673-34-8

Formula: C₅H₄BrNS

Purity: 95%

Color and Shape: Solid

Molecular weight: 190.06

Ref: 10-F078463