CAS 56674-16-9

N-[(benzyloxy)carbonyl]-L-alanyl-N~5~-(diaminomethylidene)-N-{(2S)-5-[(diaminomethylidene)amino]-2-[(4-methoxynaphthalen-2-yl)amino]pentanoyl}-L-ornithinamide

Description:

The chemical substance N-[(benzyloxy)carbonyl]-L-alanyl-N~5~-(diaminomethylidene)-N-{(2S)-5-[(diaminomethylidene)amino]-2-[(4-methoxynaphthalen-2-yl)amino]pentanoyl}-L-ornithinamide, with the CAS number 56674-16-9, is a complex organic compound characterized by its multi-functional structure. It features several amino acid residues, including L-alanine and L-ornithine, which contribute to its biological activity. The presence of diaminomethylidene groups suggests potential reactivity and interaction with biological systems, particularly in peptide synthesis or as a potential drug candidate. The benzyloxycarbonyl group serves as a protective moiety, enhancing stability and solubility. Additionally, the methoxynaphthalene moiety may impart unique optical properties or facilitate interactions with specific biological targets. Overall, this compound's intricate structure indicates potential applications in medicinal chemistry, particularly in the development of peptide-based therapeutics or as a research tool in biochemistry. Its synthesis and characterization would require advanced techniques in organic chemistry and analytical methods to confirm its purity and structural integrity.

Formula: C₃₄H₄₆N₁₀O₆

InChI: InChI=1/C34H46N10O6/c1-21(41-34(48)50-20-22-10-4-3-5-11-22)29(45)43-27(15-9-17-40-33(37)38)31(47)44-30(46)26(14-8-16-39-32(35)36)42-24-18-23-12-6-7-13-25(23)28(19-24)49-2/h3-7,10-13,18-19,21,26-27,42H,8-9,14-17,20H2,1-2H3,(H,41,48)(H,43,45)(H4,35,36,39)(H4,37,38,40)(H,44,46,47)/t21-,26-,27-/m0/s1

SMILES: C[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=O)N=C([C@H](CCCNC(=N)N)Nc1cc2ccccc2c(c1)OC)O)O)N=C(O)OCc1ccccc1

Z-Ala-Arg-Arg-4MbetaNA acetate salt

CAS: 56674-16-9

Please enquire for more information about Z-Ala-Arg-Arg-4MbetaNA acetate salt including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₃₄H₄₆N₁₀O₆

Purity: Min. 95%

Molecular weight: 690.79 g/mol

Ref: 3D-FA110621