CAS 56674-87-4

2-Adamantone-5-carboxylic acid

Description:

2-Adamantone-5-carboxylic acid is an organic compound characterized by its adamantane structure, which is a polycyclic hydrocarbon known for its stability and rigidity. This compound features a carboxylic acid functional group (-COOH) at the 5-position of the adamantone framework, contributing to its acidic properties. It typically appears as a white to off-white crystalline solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical entities. Its molecular structure allows for various chemical modifications, making it a versatile building block in organic synthesis. Additionally, 2-Adamantone-5-carboxylic acid may exhibit unique physical and chemical properties, such as melting and boiling points, which are influenced by its molecular interactions and crystalline form.

Formula: C₁₁H₁₄O₃

InChI: InChI=1/C11H14O3/c12-9-7-1-6-2-8(9)5-11(3-6,4-7)10(13)14/h6-8H,1-5H2,(H,13,14)

SMILES: C1C2CC3CC(C2)(CC1C3=O)C(=O)O

Synonyms:

• 1-Carboxy-4-adamantanone
• 4-Oxo-1-adamantanecarboxylic acid
• 4-Oxotricyclo[3.3.1.1~3,7~]Decane-1-Carboxylic Acid

4-Oxoadamantane-1-carboxylic acid

CAS: 56674-87-4

Formula: C₁₁H₁₄O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 194.2271

Ref: IN-DA00332P

4-Oxo-1-adamantanecarboxylic Acid

CAS: 56674-87-4

Formula: C₁₁H₁₄O₃

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 194.23

Ref: 3B-O0369

4-Oxoadamantane-1-carboxylic acid

CAS: 56674-87-4

4-Oxoadamantane-1-carboxylic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 194.23g/mol

Ref: 54-OR42019

4-Oxoadamantane-1-carboxylic Acid

CAS: 56674-87-4

Formula: C₁₁H₁₄O₃

Molecular weight: 194.23

Ref: 4Z-A-124019

4-Oxoadamantane-1-carboxylic acid

CAS: 56674-87-4

Formula: C₁₁H₁₄O₃

Purity: 97%

Color and Shape: Crystalline

Molecular weight: 194.23

Ref: 10-F317834

2-Adamantanone-5-Carboxylic Acid

CAS: 56674-87-4

Formula: C₁₁H₁₄O₃

Molecular weight: 194.23

Ref: ST-EA-CP-S19027

4-Oxo-1-adamantanecarboxylic acid

CAS: 56674-87-4

4-Oxo-1-adamantanecarboxylic acid is a versatile building block that can be used as a reactant and reagent in organic chemistry. It is used to synthesize various heterocyclic compounds, including the 4-oxo-1,4-dihydropyridine ring system. This compound has been shown to be useful as an intermediate or building block in the synthesis of a number of complex compounds. 4-Oxo-1-adamantanecarboxylic acid may also be used as a research chemical or speciality chemical.

Formula: C₁₁H₁₄O₃

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 194.23 g/mol

Ref: 3D-FO66564