CAS 56674-87-4
:2-Adamantone-5-carboxylic acid
Description:
2-Adamantone-5-carboxylic acid is an organic compound characterized by its adamantane structure, which is a polycyclic hydrocarbon known for its stability and rigidity. This compound features a carboxylic acid functional group (-COOH) at the 5-position of the adamantone framework, contributing to its acidic properties. It typically appears as a white to off-white crystalline solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical entities. Its molecular structure allows for various chemical modifications, making it a versatile building block in organic synthesis. Additionally, 2-Adamantone-5-carboxylic acid may exhibit unique physical and chemical properties, such as melting and boiling points, which are influenced by its molecular interactions and crystalline form.
Formula:C11H14O3
InChI:InChI=1/C11H14O3/c12-9-7-1-6-2-8(9)5-11(3-6,4-7)10(13)14/h6-8H,1-5H2,(H,13,14)
SMILES:C1C2CC3CC(C2)(CC1C3=O)C(=O)O
Synonyms:- 1-Carboxy-4-adamantanone
- 4-Oxo-1-adamantanecarboxylic acid
- 4-Oxotricyclo[3.3.1.1~3,7~]Decane-1-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Oxoadamantane-1-carboxylic acid
CAS:Formula:C11H14O3Purity:98%Color and Shape:SolidMolecular weight:194.22714-Oxo-1-adamantanecarboxylic Acid
CAS:Formula:C11H14O3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:194.234-Oxoadamantane-1-carboxylic acid
CAS:4-Oxoadamantane-1-carboxylic acidPurity:98%Color and Shape:SolidMolecular weight:194.23g/mol4-Oxoadamantane-1-carboxylic acid
CAS:Formula:C11H14O3Purity:97%Color and Shape:CrystallineMolecular weight:194.234-Oxo-1-adamantanecarboxylic acid
CAS:4-Oxo-1-adamantanecarboxylic acid is a versatile building block that can be used as a reactant and reagent in organic chemistry. It is used to synthesize various heterocyclic compounds, including the 4-oxo-1,4-dihydropyridine ring system. This compound has been shown to be useful as an intermediate or building block in the synthesis of a number of complex compounds. 4-Oxo-1-adamantanecarboxylic acid may also be used as a research chemical or speciality chemical.Formula:C11H14O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:194.23 g/mol






