CAS 56674-88-5
:Methyl 4-oxoadamantane-1-carboxylate
Description:
Methyl 4-oxoadamantane-1-carboxylate, with the CAS number 56674-88-5, is a chemical compound characterized by its adamantane structure, which is a polycyclic hydrocarbon known for its stability and unique three-dimensional shape. This compound features a carboxylate functional group and a ketone group, contributing to its reactivity and potential applications in organic synthesis. Methyl 4-oxoadamantane-1-carboxylate is typically a solid at room temperature and exhibits moderate solubility in organic solvents, such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic adamantane core. The presence of the ester group allows for various chemical transformations, making it a valuable intermediate in the synthesis of pharmaceuticals and other organic compounds. Its unique structure and functional groups may also impart interesting biological activities, although specific biological properties would require further investigation. Overall, this compound exemplifies the intersection of structural complexity and functional versatility in organic chemistry.
Formula:C12H16O3
InChI:InChI=1S/C12H16O3/c1-15-11(14)12-4-7-2-8(5-12)10(13)9(3-7)6-12/h7-9H,2-6H2,1H3
Synonyms:- 4-Oxoadamantane-1-carboxylic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 4-oxoadamantan-1-carboxylate
CAS:Formula:C12H16O3Purity:95%Color and Shape:SolidMolecular weight:208.25364-Oxo-adamantane-1-carboxylic acid methyl ester
CAS:4-Oxo-adamantane-1-carboxylic acid methyl ester is a carboxylic acid derivative with an inhibitory effect on the enzyme diacylglycerol acyltransferase (DGAT). This inhibition leads to reduced levels of triglycerides in the blood. The compound has been shown to be safe for use in humans, and does not affect bodyweight or plasma triglyceride levels. 4-Oxo-adamantane-1-carboxylic acid methyl ester has been shown to be effective at lowering plasma triglyceride levels in patients with diabetes. This compound is also druggable and can be used as a lead structure for drug development.br>br>Formula:C12H16O3Purity:Min. 95%Molecular weight:208.25 g/mol


