CymitQuimica logo

CAS 56681-55-1

:

N-(2,6-diethylphenyl)-2-hydroxy-N-(methoxymethyl)acetamide

Description:
N-(2,6-diethylphenyl)-2-hydroxy-N-(methoxymethyl)acetamide, with the CAS number 56681-55-1, is a chemical compound that belongs to the class of acetamides. This substance features a hydroxyl group (-OH) and a methoxymethyl group (-OCH2O-) attached to an acetamide backbone, which contributes to its potential solubility and reactivity. The presence of the 2,6-diethylphenyl group enhances its lipophilicity, potentially influencing its biological activity and interaction with various biological targets. This compound may exhibit properties such as analgesic or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it could participate in hydrogen bonding due to the hydroxyl group, which may affect its physical properties, such as melting point and solubility in polar solvents. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C14H21NO3
InChI:InChI=1/C14H21NO3/c1-4-11-7-6-8-12(5-2)14(11)15(10-18-3)13(17)9-16/h6-8,16H,4-5,9-10H2,1-3H3
SMILES:CCc1cccc(CC)c1N(COC)C(=O)CO
Synonyms:
  • acetamide, N-(2,6-diethylphenyl)-2-hydroxy-N-(methoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.