CAS 56682-66-7
:3-[(E)-(hydroxyimino)methyl]quinolin-2(1H)-one
Description:
3-[(E)-(hydroxyimino)methyl]quinolin-2(1H)-one, with the CAS number 56682-66-7, is a chemical compound characterized by its quinoline core structure, which is a bicyclic aromatic compound. This substance features a hydroxylamine functional group, specifically an E-isomer configuration, indicating the presence of a double bond with specific stereochemistry. The compound exhibits properties typical of both quinolines and hydroxylamines, including potential biological activity, such as antimicrobial or antitumor effects, due to its ability to interact with biological targets. The presence of the hydroxymethyl group enhances its reactivity and solubility in polar solvents. Additionally, the compound may participate in various chemical reactions, including condensation and oxidation, making it of interest in synthetic organic chemistry. Its unique structure allows for potential applications in pharmaceuticals and agrochemicals, although specific biological activities and mechanisms would require further investigation through experimental studies.
Formula:C10H8N2O2
InChI:InChI=1/C10H8N2O2/c13-10-8(6-11-14)5-7-3-1-2-4-9(7)12-10/h1-6,14H,(H,12,13)/b11-6+
Synonyms:- 2-Oxo-1,2-Dihydroquinoline-3-Carbaldehyde Oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,2-Dihydro-2-oxoquinoline-3-carboxaldehyde oxime
CAS:1,2-Dihydro-2-oxoquinoline-3-carboxaldehyde oxime
Molecular weight:188.18g/mol

