CAS 566926-05-4

N-[(4-Bromophenyl)methyl]-2-cyanoacetamide

Description:

N-[(4-Bromophenyl)methyl]-2-cyanoacetamide, identified by its CAS number 566926-05-4, is an organic compound characterized by its unique functional groups. It features a cyano group (-C≡N) and an amide group (-C(=O)NH-) which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the 4-bromophenylmethyl moiety enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. This compound may exhibit various properties such as moderate to high melting points and stability under standard laboratory conditions, although specific thermal and solubility characteristics would depend on the purity and specific formulation. Its structure suggests potential use in the development of pharmaceuticals, particularly in the synthesis of compounds with anti-inflammatory or anticancer properties. As with many organic compounds, safety precautions should be observed when handling, as it may pose health risks if ingested or inhaled. Further studies would be necessary to fully elucidate its chemical behavior and potential applications.

Formula: C₁₀H₉BrN₂O

InChI: InChI=1S/C10H9BrN2O/c11-9-3-1-8(2-4-9)7-13-10(14)5-6-12/h1-4H,5,7H2,(H,13,14)

InChI key: InChIKey=LMJXGMLFBKFUFC-UHFFFAOYSA-N

SMILES: C(NC(CC#N)=O)C1=CC=C(Br)C=C1

Synonyms:

• N-[(4-Bromophenyl)methyl]-2-cyanoacetamide
• Acetamide, N-[(4-bromophenyl)methyl]-2-cyano-

N-[(4-Bromophenyl)methyl]-2-cyanoacetamide

CAS: 566926-05-4

Versatile small molecule scaffold

Formula: C₁₀H₉BrN₂O

Purity: Min. 95%

Molecular weight: 253.09 g/mol

Ref: 3D-RXA92605