CAS 56693-13-1
:α-[[(1-Ethynylcyclohexyl)oxy]methyl]-4-(2-methoxyphenyl)-1-piperazineethanol
Description:
α-[[(1-Ethynylcyclohexyl)oxy]methyl]-4-(2-methoxyphenyl)-1-piperazineethanol, with CAS number 56693-13-1, is a chemical compound that belongs to the class of piperazine derivatives. This substance is characterized by its complex molecular structure, which includes a piperazine ring, an ethynyl group, and a methoxyphenyl moiety. The presence of the ethynyl group suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The compound's functional groups contribute to its solubility and reactivity, making it of interest in various chemical reactions. Additionally, the piperazine ring is often associated with biological activity, which may indicate potential pharmacological properties. However, specific data regarding its biological effects, toxicity, and applications may require further investigation. Overall, this compound exemplifies the diverse chemistry associated with piperazine derivatives and their potential utility in various fields, including drug development and material science.
Formula:C22H32N2O3
InChI:InChI=1/C22H32N2O3/c1-3-22(11-7-4-8-12-22)27-18-19(25)17-23-13-15-24(16-14-23)20-9-5-6-10-21(20)26-2/h1,5-6,9-10,19,25H,4,7-8,11-18H2,2H3
InChI key:InChIKey=UWDDRCRFIZGSCD-UHFFFAOYSA-N
SMILES:O(CC(CN1CCN(CC1)C2=C(OC)C=CC=C2)O)C3(C#C)CCCCC3
Synonyms:- Mociprazina [INN-Spanish]
- Mociprazine
- Mociprazine [INN]
- UNII-L3L0CM26R6
- alpha-(((1-Ethynylcyclohexyl)oxy)methyl)-4-(o-methoxyphenyl)-1-piperazineethanol
- α-[[(1-Ethynylcyclohexyl)oxy]methyl]-4-(2-methoxyphenyl)-1-piperazineethanol
- Mociprazinum
- 1-(1-Ethinylcyclohexyloxy)-3-(4-(2-methoxyphenyl)-1-piperazinyl-2-propanol
- 1-[(1-ethynylcyclohexyl)oxy]-3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-2-ol
- Mociprazin
- 3517CERM
- CERM 3517
- Mociprazinum [INN-Latin]
- 1-Piperazineethanol, α-[[(1-ethynylcyclohexyl)oxy]methyl]-4-(2-methoxyphenyl)-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mociprazine
CAS:Mociprazine is a biochemical.Formula:C22H32N2O3Color and Shape:SolidMolecular weight:372.50
