CAS 56699-23-1

methyl (3,5-dimethyl-1H-pyrazol-4-yl)acetate

Description:

Methyl (3,5-dimethyl-1H-pyrazol-4-yl)acetate is an organic compound characterized by its pyrazole ring structure, which contributes to its unique chemical properties. This compound features a methyl ester functional group, indicating it can participate in esterification reactions. The presence of two methyl groups on the pyrazole ring enhances its lipophilicity and may influence its biological activity. Typically, compounds like this can exhibit a range of properties, including solubility in organic solvents and potential reactivity with nucleophiles due to the ester group. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the specific arrangement of substituents on the pyrazole ring can affect its stability, reactivity, and interaction with biological targets. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, methyl (3,5-dimethyl-1H-pyrazol-4-yl)acetate represents a versatile compound with interesting chemical characteristics.

Formula: C₈H₁₂N₂O₂

InChI: InChI=1/C8H12N2O2/c1-5-7(4-8(11)12-3)6(2)10-9-5/h4H2,1-3H3,(H,9,10)

SMILES: Cc1c(CC(=O)OC)c(C)n[nH]1

Methyl (3,5-dimethyl-1h-pyrazol-4-yl)acetate

CAS: 56699-23-1

Formula: C₈H₁₂N₂O₂

Molecular weight: 168.1931

Ref: IN-DA00ECN3

Methyl (3,5-dimethyl-1H-pyrazol-4-yl)acetate

CAS: 56699-23-1

Methyl (3,5-dimethyl-1H-pyrazol-4-yl)acetate

Purity: 96%

Molecular weight: 168.19g/mol

Ref: 54-OR965647