CAS 567-35-1
:cis-3-Hydroxy-L-proline
Description:
Cis-3-Hydroxy-L-proline is a naturally occurring amino acid derivative characterized by its unique structural features and stereochemistry. It is a cyclic amino acid, specifically a proline analog, where the hydroxyl group is positioned at the 3rd carbon in the cis configuration relative to the nitrogen atom in the pyrrolidine ring. This configuration influences its physical and chemical properties, including solubility and reactivity. The compound is typically a white to off-white crystalline solid and is soluble in water and polar solvents due to the presence of the hydroxyl group. Cis-3-Hydroxy-L-proline plays a significant role in biological systems, particularly in the stabilization of protein structures and as a building block in peptide synthesis. Its unique properties make it of interest in various fields, including medicinal chemistry and materials science, where it may be utilized in the development of pharmaceuticals and biomaterials. Additionally, its CAS number, 567-35-1, is used for identification in chemical databases and regulatory contexts.
Formula:C5H9NO3
InChI:InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m1/s1
InChI key:InChIKey=BJBUEDPLEOHJGE-DMTCNVIQSA-N
SMILES:C(O)(=O)[C@@H]1[C@H](O)CCN1
Synonyms:- (3R)-3-Hydroxy-L-proline
- L-Proline, 3-hydroxy-, (3R)-
- Proline, 3-hydroxy-, L-cis-
- 3-Allohydroxy-L-proline
- L-Proline, 3-hydroxy-, cis-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2S,3R)-3-Hydroxypyrrolidine-2-carboxylic acid
CAS:(2S,3R)-3-Hydroxypyrrolidine-2-carboxylic acidPurity:95%Molecular weight:131.13g/molcis-3-Hydroxy-L-proline
CAS:cis-3-Hydroxy-L-proline is a natural amino acid that has been synthesized in the laboratory. It is an important intermediate in the synthesis of many plant secondary metabolites such as alkaloids and flavonoids, which are used as medicines. The enzyme hydroxylase catalyzes the conversion of L-proline to cis-3-hydroxy-L-proline, which involves a dehydration reaction followed by an asymmetric synthesis. The enzyme is regulated transcriptionally by feedback inhibition by 3-hydroxyisobutyric acid, which inhibits its activity.Formula:C5H9NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:131.13 g/mol(2S,3R)-3-Hydroxypyrrolidine-2-carboxylic acid
CAS:Formula:C5H9NO3Purity:95%Color and Shape:SolidMolecular weight:131.131cis-L-3-Hydroxyproline
CAS:Applications cis-L-3-Hydroxyproline is a versatile building block, used in the synthesis of various pharmaceutical and biologically active compounds. It is an isomer to trans-3-Hydroxyproline (H950925).
References Al-Momani, L., Jordan Journal of Chemistry, 7, 141 (2012);Formula:C5H9NO3Color and Shape:White To Off-WhiteMolecular weight:131.13




