CymitQuimica logo

CAS 567-75-9

:

Leptospermone

Description:
Leptospermone is a natural organic compound classified as a ketone, primarily derived from the leaves of the Leptospermum species, particularly the tea tree. It is known for its distinctive aromatic properties and is often associated with antimicrobial and antifungal activities. The molecular structure of leptospermone features a bicyclic framework, which contributes to its biological activity. This compound has garnered interest in various fields, including agriculture, where it is explored for its potential as a natural herbicide due to its ability to inhibit the growth of certain plant species. Additionally, leptospermone exhibits potential applications in the pharmaceutical industry, particularly in the development of new therapeutic agents. Its solubility in organic solvents and relatively low volatility make it suitable for various formulations. However, as with many natural products, the specific effects and safety profiles of leptospermone require further investigation to fully understand its potential uses and implications in different applications.
Formula:C15H22O4
InChI:InChI=1S/C15H22O4/c1-8(2)7-9(16)10-11(17)14(3,4)13(19)15(5,6)12(10)18/h8,10H,7H2,1-6H3
InChI key:InChIKey=YDWYMAHAWHBPPT-UHFFFAOYSA-N
SMILES:C(CC(C)C)(=O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O
Synonyms:
  • 1,3,5-Cyclohexanetrione, 2,2,4,4-tetramethyl-6-(3-methyl-1-oxobutyl)-
  • 1,3,5-Cyclohexanetrione, 6-isovaleryl-2,2,4,4-tetramethyl-
  • 2,2,4,4-Tetramethyl-6-(3-methyl-1-oxobutyl)-1,3,5-cyclohexanetrione
  • Leptospermone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.