CAS 56701-24-7

3,4-Dihydro-3-(2-hydroxy-4-methoxyphenyl)-2H-1-benzopyran-7-ol

Description:

3,4-Dihydro-3-(2-hydroxy-4-methoxyphenyl)-2H-1-benzopyran-7-ol, with the CAS number 56701-24-7, is a chemical compound that belongs to the class of flavonoids, specifically a type of benzopyran. This compound features a benzopyran core structure, which is characterized by a fused benzene and pyran ring. Its molecular structure includes hydroxyl and methoxy functional groups, contributing to its potential biological activity. The presence of the hydroxy group may enhance its antioxidant properties, while the methoxy group can influence its solubility and reactivity. This compound is of interest in various fields, including medicinal chemistry and pharmacology, due to its potential therapeutic effects, such as anti-inflammatory and antioxidant activities. Additionally, its structural features may allow for interactions with biological targets, making it a candidate for further research in drug development. Overall, 3,4-Dihydro-3-(2-hydroxy-4-methoxyphenyl)-2H-1-benzopyran-7-ol exemplifies the diverse functionalities and applications of flavonoid derivatives in scientific research.

Formula: C₁₆H₁₆O₄

InChI: InChI=1S/C16H16O4/c1-19-13-4-5-14(15(18)8-13)11-6-10-2-3-12(17)7-16(10)20-9-11/h2-5,7-8,11,17-18H,6,9H2,1H3

InChI key: InChIKey=XRVFNNUXNVWYTI-UHFFFAOYSA-N

SMILES: OC1=C(C=CC(OC)=C1)C2CC=3C(OC2)=CC(O)=CC3

Synonyms:

• (±)-Vestitol
• 2H-1-benzopyran-7-ol, 3,4-dihydro-3-(2-hydroxy-4-methoxyphenyl)-
• 3,4-Dihydro-3-(2-hydroxy-4-methoxyphenyl)-2H-1-benzopyran-7-ol
• 3-(2-Hydroxy-4-methoxyphenyl)-7-chromanol

2H-1-BENZOPYRAN-7-OL, 3,4-DIHYDRO-3-(2-HYDROXY-4-METHOXYPHENYL)-

CAS: 56701-24-7

Formula: C₁₆H₁₆O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 272.2958

Ref: IN-DA00EABV

DL-Vestitol

CAS: 56701-24-7

DL-Vestitol

Purity: 98%

Molecular weight: 272.3g/mol

Ref: 54-OR1067239

(±)-Vestitol

CAS: 56701-24-7

Formula: C₁₆H₁₆O₄

Purity: 95%~99%

Molecular weight: 272.3

Ref: BP-SBP03647

(+/-)-Vestitol

CAS: 56701-24-7

(+/-)-Vestitol is a bioactive flavonoid compound primarily found in leguminous plants, such as those in the Fabaceae family. It is a pyrano-isoflavonoid known for its role as a natural defense molecule synthesized by certain plants. Vestitol operates by disrupting microbial cell membranes and modulating inflammatory pathways, which contributes to its antimicrobial and anti-inflammatory properties.

Formula: C₁₆H₁₆O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 272.29 g/mol

Ref: 3D-GCA70124

(+/-)-Vestitol

CAS: 56701-24-7

Vestitol: potent antioxidant, anti-inflammatory, antimicrobial; effective at low doses; potential in pharma and food industries; inhibits neutrophil migration.

Formula: C₁₆H₁₆O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 272.3

Ref: TM-TN5227