CAS 56719-08-5
:3-(2,5-dichlorophenyl)-3-oxopropanenitrile
Description:
3-(2,5-Dichlorophenyl)-3-oxopropanenitrile, with the CAS number 56719-08-5, is an organic compound characterized by its unique structure, which includes a nitrile functional group and a ketone moiety. This compound features a 2,5-dichlorophenyl group attached to a propanone backbone, contributing to its potential reactivity and biological activity. The presence of chlorine atoms enhances its lipophilicity and may influence its interaction with biological systems. Typically, compounds like this may exhibit properties such as moderate to high stability under standard conditions, but they can be sensitive to hydrolysis or other nucleophilic attacks due to the nitrile and carbonyl functionalities. The compound may also possess specific applications in pharmaceuticals or agrochemicals, given the presence of the dichlorophenyl group, which is often associated with bioactive properties. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential toxicity associated with chlorinated aromatic compounds.
Formula:C9H5Cl2NO
InChI:InChI=1/C9H5Cl2NO/c10-6-1-2-8(11)7(5-6)9(13)3-4-12/h1-2,5H,3H2
SMILES:c1cc(c(cc1Cl)C(=O)CC#N)Cl
Synonyms:- Benzenepropanenitrile, 2,5-Dichloro-Β-Oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
