CAS 5672-83-3
:4-{[(benzyloxy)carbonyl]amino}-5-methoxy-5-oxopentanoic acid (non-preferred name)
Description:
4-{[(Benzyloxy)carbonyl]amino}-5-methoxy-5-oxopentanoic acid, also known by its CAS number 5672-83-3, is an organic compound characterized by its complex structure that includes an amino acid derivative. This substance features a benzyloxycarbonyl group, which enhances its stability and solubility, making it suitable for various biochemical applications. The presence of a methoxy group contributes to its unique reactivity and potential interactions in biological systems. As a pentanoic acid derivative, it possesses both acidic and basic functional groups, allowing it to participate in various chemical reactions, including peptide synthesis and enzyme catalysis. Its structural attributes may also influence its pharmacological properties, making it of interest in medicinal chemistry. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity, highlighting its potential utility in research and therapeutic contexts.
Formula:C14H17NO6
InChI:InChI=1/C14H17NO6/c1-20-13(18)11(7-8-12(16)17)15-14(19)21-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,15,19)(H,16,17)
SMILES:COC(=O)C(CCC(=O)O)N=C(O)OCc1ccccc1
Synonyms:- [({[(1S)-3-carboxylato-1-(methoxycarbonyl)propyl]carbamoyl}oxy)methyl]benzene
- (4S)-4-{[(benzyloxy)carbonyl]amino}-5-methoxy-5-oxopentanoic acid (non-preferred name)
- Z-Glu-OMe
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-Methyl N-Carbobenzoxy-L-glutamate
CAS:Formula:C14H17NO6Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:295.29N-Benzyloxycarbonyl-L-glutamic acid 1-methyl ester, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C14H17NO6Purity:98%Molecular weight:295.291-Methyl N-Carbobenzoxy-L-Glutamate
CAS:Formula:C14H17NO6Purity:97%Color and Shape:SolidMolecular weight:295.28791-Methyl N-Carbobenzoxy-L-Glutamate
CAS:1-Methyl N-Carbobenzoxy-L-GlutamatePurity:98%Molecular weight:295.29g/molZ-Glu-OMe
CAS:M03049 - Z-Glu-OMe
Formula:C14H17NO6Purity:97%Color and Shape:SolidMolecular weight:295.291Z-Glu-OMe
CAS:Bachem ID: 4016433.
Formula:C14H17NO6Purity:> 99%Color and Shape:White PowderMolecular weight:295.29






