CAS 5672-84-4
:4-bromophenyl trifluoroacetate
Description:
4-Bromophenyl trifluoroacetate is an organic compound characterized by the presence of a bromine atom and a trifluoroacetate functional group attached to a phenyl ring. Its molecular structure features a bromobenzene moiety, where the bromine atom is positioned at the para position relative to the ester group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly in nucleophilic substitution reactions, due to the electrophilic nature of the trifluoroacetate group. The trifluoroacetate moiety imparts unique properties, such as increased lipophilicity and stability against hydrolysis compared to other acetate esters. Additionally, 4-bromophenyl trifluoroacetate can be utilized in various synthetic applications, including the preparation of pharmaceuticals and agrochemicals. Safety considerations should be taken into account, as it may pose hazards typical of halogenated organic compounds, including potential toxicity and environmental impact. Proper handling and disposal protocols are essential when working with this substance.
Formula:C8H4BrF3O2
InChI:InChI=1/C8H4BrF3O2/c9-5-1-3-6(4-2-5)14-7(13)8(10,11)12/h1-4H
SMILES:c1cc(ccc1Br)OC(=O)C(F)(F)F
Synonyms:- Acetic Acid, 2,2,2-Trifluoro-, 4-Bromophenyl Ester
- 4-Bromophenyl trifluoroacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
