CAS 56720-93-5

2-[(1-phenylethyl)amino]acetohydrazide (non-preferred name)

Description:

2-[(1-phenylethyl)amino]acetohydrazide, also known by its CAS number 56720-93-5, is an organic compound characterized by the presence of both hydrazide and amine functional groups. This substance features a hydrazide moiety, which is a derivative of hydrazine, and an ethyl group substituted with a phenyl ring, contributing to its aromatic properties. The compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the hydrazide and amine functionalities. Its structure allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. 2-[(1-phenylethyl)amino]acetohydrazide may exhibit biological activity, making it of interest in medicinal chemistry and drug development. However, specific applications and biological effects would require further investigation and validation through experimental studies. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₀H₁₅N₃O

InChI: InChI=1/C10H15N3O/c1-8(12-7-10(14)13-11)9-5-3-2-4-6-9/h2-6,8,12H,7,11H2,1H3,(H,13,14)

SMILES: CC(c1ccccc1)NCC(=NN)O

Synonyms:

• (1-Phenyl-ethylamino)-acetic acid hydrazide

2-[(1-Phenylethyl)amino]acetohydrazide

CAS: 56720-93-5

Versatile small molecule scaffold

Formula: C₁₀H₁₅N₃O

Purity: Min. 95%

Molecular weight: 193.25 g/mol

Ref: 3D-GCA72093