CAS 56734-74-8
:Trifluoromethylcyclohexanone
Description:
Trifluoromethylcyclohexanone is an organic compound characterized by the presence of a trifluoromethyl group (-CF3) attached to a cyclohexanone structure. This compound typically exhibits a colorless to pale yellow liquid form and has a distinctive odor. The trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and altering its reactivity compared to non-fluorinated analogs. Trifluoromethylcyclohexanone is known for its utility in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, including nucleophilic substitutions and reductions. The presence of the carbonyl group (ketone) contributes to its reactivity, allowing it to undergo condensation reactions and serve as a precursor for more complex molecules. Additionally, this compound's fluorinated nature may impart unique physical properties, such as increased thermal stability and altered solubility in organic solvents. Safety considerations should be taken into account when handling this compound, as with many fluorinated organic substances.
Formula:C7H9F3O
InChI:InChI=1/C7H9F3O/c8-7(9,10)5-3-1-2-4-6(5)11/h5H,1-4H2
SMILES:C1CCC(=O)C(C1)C(F)(F)F
Synonyms:- 2-(Trifluoromethyl)cyclohexanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(Trifluoromethyl)cyclohexanone, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H9F3OPurity:97%Color and Shape:Liquid, Clear colorless to pale yellowMolecular weight:166.142-(Trifluoromethyl)cyclohexanone
CAS:Formula:C7H9F3OPurity:97%Color and Shape:LiquidMolecular weight:166.14102-(Trifluoromethyl)cyclohexanone
CAS:2-(Trifluoromethyl)cyclohexanoneFormula:C7H9F3OPurity:97%Color and Shape: clear. yellow liquidMolecular weight:166.14g/mol


