CymitQuimica logo

CAS 56735-29-6

:

α-(2-Acetylhydrazinylidene)benzeneacetic acid hydrazide

Description:
α-(2-Acetylhydrazinylidene)benzeneacetic acid hydrazide, with the CAS number 56735-29-6, is a chemical compound that features a hydrazide functional group, which is characterized by the presence of a hydrazine moiety (-NH-NH2) linked to a carboxylic acid derivative. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, including potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of amine and carbonyl groups. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure suggests it could participate in various chemical reactions, such as nucleophilic substitutions or cyclization, depending on the conditions. Additionally, its solubility and stability can vary based on the solvent and pH, which are important factors for its application in research and industry. Overall, this compound represents a unique intersection of hydrazine chemistry and aromatic compounds, with potential applications in various fields.
Formula:C10H12N4O2
InChI:InChI=1S/C10H12N4O2/c1-7(15)13-14-9(10(16)12-11)8-5-3-2-4-6-8/h2-6H,11H2,1H3,(H,12,16)(H,13,15)
InChI key:InChIKey=GMMXCUJVWPKZDL-UHFFFAOYSA-N
SMILES:C(=NNC(C)=O)(C(NN)=O)C1=CC=CC=C1
Synonyms:
  • (2Z)-2-(2-acetylhydrazinylidene)-2-phenylethanehydrazide
  • Benzeneacetic acid, α-(2-acetylhydrazinylidene)-, hydrazide
  • Benzeneacetic acid, α-(acetylhydrazono)-, hydrazide
  • α-(2-Acetylhydrazinylidene)benzeneacetic acid hydrazide
  • 2-(Acetylhydrazono)-2-phenylacetohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.