CAS 56742-44-0
:3-deoxy-D-threo-hex-2-ulosonic acid
Description:
3-Deoxy-D-threo-hex-2-ulosonic acid, commonly referred to as KDO (2-keto-3-deoxy-D-manno-octulosonic acid), is a sugar acid that plays a significant role in the structure of bacterial lipopolysaccharides. It is characterized by its six-carbon backbone with a ketone functional group and a carboxylic acid group, which contribute to its acidic properties. KDO is typically found in the form of a white to off-white crystalline powder and is soluble in water, making it accessible for various biochemical applications. This compound is crucial for the integrity of the outer membrane of Gram-negative bacteria, where it is involved in the formation of polysaccharides. Its presence is essential for bacterial virulence and can influence immune responses in host organisms. KDO is also utilized in research and industrial applications, particularly in the study of bacterial cell wall synthesis and as a potential target for antibiotic development. Overall, 3-deoxy-D-threo-hex-2-ulosonic acid is an important biochemical compound with significant implications in microbiology and biochemistry.
Formula:C6H10O6
InChI:InChI=1/C6H10O6/c7-2-5(10)3(8)1-4(9)6(11)12/h3,5,7-8,10H,1-2H2,(H,11,12)/t3-,5-/m1/s1
SMILES:C([C@H]([C@@H](CO)O)O)C(=O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Deoxy-2-keto-D-galactonate lithium salt
CAS:<p>3-Deoxy-2-keto-D-galactonate lithium salt is an enzyme inhibitor that belongs to the group of galacturonosyltransferases. It is a competitive inhibitor that binds to the enzyme active site and inhibits the transfer of galacturonic acid from UDP-galactose to various acceptor molecules, including oligosaccharides, polysaccharides, glycoproteins, and glycolipids. 3-Deoxy-2-keto-D-galactonate lithium salt has been shown to inhibit wild type strains of Escherichia coli and Saccharomyces cerevisiae. This compound also inhibits acid analysis enzymes such as catalase and triosephosphate isomerase in Escherichia coli. 3DGLS also inhibits protein synthesis by inhibiting the activity of enzymes such as ribonucleotide reductase and xanthine oxidase in Escherichia coli. The</p>Formula:C6H10O6·xLiPurity:Min. 95%
