CAS 56745-01-8

5-bromo-2,4-dichloro-6-methylpyrimidine

Description:

5-Bromo-2,4-dichloro-6-methylpyrimidine is a heterocyclic organic compound belonging to the pyrimidine family, characterized by a six-membered ring containing two nitrogen atoms at positions 1 and 3. This compound features multiple halogen substituents, specifically bromine and chlorine, which contribute to its reactivity and potential applications in various chemical reactions. The presence of a methyl group at the 6-position enhances its lipophilicity, influencing its solubility and interaction with biological systems. It is often utilized in the synthesis of pharmaceuticals and agrochemicals due to its ability to act as a building block in the formation of more complex molecules. The compound's structure allows for diverse reactivity, including nucleophilic substitutions and coupling reactions. Additionally, its halogenated nature may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 5-bromo-2,4-dichloro-6-methylpyrimidine is a valuable compound in synthetic organic chemistry.

Formula: C₅H₃BrCl₂N₂

InChI: InChI=1/C5H3BrCl2N2/c1-2-3(6)4(7)10-5(8)9-2/h1H3

SMILES: Cc1c(c(Cl)nc(Cl)n1)Br

Synonyms:

• Pyrimidine, 5-Bromo-2,4-Dichloro-6-Methyl-
• 5-Bromo-2,4-dichloro-6-methylpyrimidine

5-Bromo-2,4-dichloro-6-methylpyrimidine

CAS: 56745-01-8

Formula: C₅H₃BrCl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 241.9007

Ref: IN-DA003MGG

5-Bromo-2,4-dichloro-6-methylpyrimidine

CAS: 56745-01-8

5-Bromo-2,4-dichloro-6-methylpyrimidine

Purity: 98%

Molecular weight: 241.90g/mol

Ref: 54-OR80485

5-Bromo-2,4-dichloro-6-methylpyrimidine

CAS: 56745-01-8

Formula: C₅H₃BrCl₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 241.9

Ref: 10-F077077