CAS 56750-95-9
:(1E)-1-(1,3-benzodioxol-5-yl)-5-methylhex-1-en-3-one
Description:
The chemical substance known as (1E)-1-(1,3-benzodioxol-5-yl)-5-methylhex-1-en-3-one, with the CAS number 56750-95-9, is an organic compound characterized by its unique structural features. It contains a hexene backbone with a methyl group and a conjugated carbonyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the 1,3-benzodioxole moiety enhances its aromatic properties, which may influence its biological activity and interactions. This compound is likely to exhibit properties typical of unsaturated ketones, such as susceptibility to electrophilic addition reactions. Additionally, its structural configuration suggests potential for isomerization and other stereochemical transformations. The compound may also possess interesting optical properties due to its conjugated system. Overall, its unique structure positions it as a candidate for various applications in fields such as pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C14H16O3
InChI:InChI=1/C14H16O3/c1-10(2)7-12(15)5-3-11-4-6-13-14(8-11)17-9-16-13/h3-6,8,10H,7,9H2,1-2H3/b5-3+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
