CAS 56759-32-1

1-(4-Amino-3-bromophenyl)ethanone

Description:

1-(4-Amino-3-bromophenyl)ethanone, with the CAS number 56759-32-1, is an organic compound characterized by its functional groups and structural features. It contains an ethanone moiety, indicating the presence of a ketone group, and an amino group attached to a phenyl ring that is further substituted with a bromine atom. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the amino group. The bromine substitution can influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the amino group can participate in hydrogen bonding, affecting its physical properties and interactions with other molecules. The compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, given its functional groups that can be modified for further chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₈BrNO

InChI: InChI=1/C8H8BrNO/c1-5(11)6-2-3-8(10)7(9)4-6/h2-4H,10H2,1H3

SMILES: CC(=O)c1ccc(c(c1)Br)N

Synonyms:

• Ethanone, 1-(4-Amino-3-Bromophenyl)-

1-(4-Amino-3-Bromo-Phenyl)-Ethanone

CAS: 56759-32-1

Formula: C₈H₈BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 214.0592

Ref: IN-DA00EDC6

4-Amino-3-bromoacetophenone

CAS: 56759-32-1

4-Amino-3-bromoacetophenone

Purity: 97%

Molecular weight: 214.05922g/mol

Ref: 54-OR480776

1-(4-Amino-3-bromophenyl)ethanone

CAS: 56759-32-1

Formula: C₈H₈BrNO

Purity: 96%

Color and Shape: Solid

Molecular weight: 214.062

Ref: 10-F210860