CAS 5676-60-8

6-Amino-2-methylbenzoxazole

Description:

6-Amino-2-methylbenzoxazole is an organic compound characterized by its benzoxazole structure, which consists of a fused benzene and oxazole ring. This compound features an amino group (-NH2) at the 6-position and a methyl group (-CH3) at the 2-position of the benzoxazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical entities. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₈N₂O

InChI: InChI=1/C8H8N2O/c1-5-10-7-3-2-6(9)4-8(7)11-5/h2-4H,9H2,1H3

SMILES: Cc1nc2ccc(cc2o1)N

Synonyms:

• 2-Methyl-1,3-benzoxazol-6-amin
• 2-Methyl-1,3-benzoxazol-6-amine
• 6-Benzoxazolamine, 2-Methyl-

6-Amino-2-methylbenzoxazole

CAS: 5676-60-8

Formula: C₈H₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 148.1619

Ref: IN-DA00EBZK

2-Methyl-1,3-benzoxazol-6-amine

CAS: 5676-60-8

2-Methyl-1,3-benzoxazol-6-amine

Formula: C₈H₈N₂O

Purity: ≥95%

Color and Shape: light red solid

Molecular weight: 148.16g/mol

Ref: 54-OR110719

2-Methylbenzo[d]oxazol-6-amine

CAS: 5676-60-8

Formula: C₈H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 148.165

Ref: 10-F236592