CAS 5676-71-1
:Bis(4-methoxyphenyl) carbonate
Description:
Bis(4-methoxyphenyl) carbonate, with the CAS number 5676-71-1, is an organic compound characterized by its carbonate functional group bonded to two 4-methoxyphenyl groups. This compound typically appears as a colorless to pale yellow solid and is known for its moderate solubility in organic solvents such as acetone and ethyl acetate, while being less soluble in water. It exhibits a relatively high melting point, indicative of its crystalline structure. Bis(4-methoxyphenyl) carbonate is often utilized in the synthesis of polymers and as an intermediate in organic synthesis due to its reactivity, particularly in nucleophilic substitution reactions. Additionally, it may possess potential applications in the field of materials science, particularly in the development of coatings and adhesives. The presence of methoxy groups enhances its electron-donating properties, which can influence its reactivity and interactions with other chemical species. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.
Formula:C15H14O5
InChI:InChI=1/C15H14O5/c1-17-11-3-7-13(8-4-11)19-15(16)20-14-9-5-12(18-2)6-10-14/h3-10H,1-2H3
SMILES:COc1ccc(cc1)OC(=O)Oc1ccc(cc1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
