CAS 56762-32-4

1-(2-amino-3-chlorophenyl)ethanone

Description:

1-(2-amino-3-chlorophenyl)ethanone, also known by its CAS number 56762-32-4, is an organic compound characterized by the presence of an ethanone functional group attached to a phenyl ring that has both an amino group and a chlorine substituent. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents. The amino group (-NH2) contributes to its potential as a building block in pharmaceuticals and agrochemicals, while the chlorine atom can influence its reactivity and biological activity. The presence of both electron-donating (amino) and electron-withdrawing (chloro) groups on the aromatic ring can affect the compound's electronic properties, making it of interest in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and reactivity.

Formula: C₈H₈ClNO

InChI: InChI=1/C8H8ClNO/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,10H2,1H3

SMILES: CC(=O)c1cccc(c1N)Cl

Ethanone,1-(2-amino-3-chlorophenyl)-

CAS: 56762-32-4

Formula: C₈H₈ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.6082

Ref: IN-DA00EECL

1-(2-Amino-3-chlorophenyl)ethanone

CAS: 56762-32-4

1-(2-Amino-3-chlorophenyl)ethanone

Purity: 98%

Molecular weight: 169.61g/mol

Ref: 54-OR92735

1-(2-Amino-3-chlorophenyl)ethanone

CAS: 56762-32-4

Purity: 98%

Molecular weight: 169.61

Ref: 10-F626359