CAS 56766-80-4
:Ethanamine, 2,2-dimethoxy-N-methyl-, hydrochloride (1:1)
Description:
Ethanamine, 2,2-dimethoxy-N-methyl-, hydrochloride (1:1), with the CAS number 56766-80-4, is a chemical compound characterized by its amine functional group and the presence of methoxy groups. This substance typically appears as a white crystalline solid and is soluble in water due to the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the dimethoxy groups contributes to its unique chemical reactivity and potential applications in organic synthesis and medicinal chemistry. As a tertiary amine, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. The hydrochloride form indicates that it is a salt formed from the reaction of the amine with hydrochloric acid, which can influence its stability and handling characteristics. Safety data should be consulted for proper handling, as with all chemical substances, to ensure safe usage in laboratory or industrial settings.
Formula:C5H13NO2·ClH
InChI:InChI=1S/C5H13NO2.ClH/c1-6-4-5(7-2)8-3;/h5-6H,4H2,1-3H3;1H
InChI key:InChIKey=VRFVCWXHJCQSHZ-UHFFFAOYSA-N
SMILES:C(CNC)(OC)OC.Cl
Synonyms:- Ethanamine, 2,2-dimethoxy-N-methyl-, hydrochloride
- 2,2-dimethoxy-N-methylethanaminium chloride
- 2,2-Dimethoxyethyl(methyl)ammonium chloride
- Ethanamine, 2,2-dimethoxy-N-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thiamazole EP Impurity A HCl (Methimazole USP Related Compound A HCl)
CAS:Formula:C5H13NO2·HClColor and Shape:White To Off-White SolidMolecular weight:119.16 36.46
