CAS 56782-52-6
:L-Isoleucine, ethyl ester, hydrochloride (1:1)
Description:
L-Isoleucine, ethyl ester, hydrochloride (1:1) is a derivative of the essential amino acid isoleucine, which plays a crucial role in protein synthesis and metabolic processes. This compound is characterized by its ethyl ester form, which enhances its solubility and bioavailability compared to the free amino acid. As a hydrochloride salt, it is typically more stable and easier to handle in various applications, including pharmaceuticals and nutritional supplements. The presence of the hydrochloride group also contributes to its solubility in water, making it suitable for various formulations. L-Isoleucine is known for its role in muscle metabolism and energy production, making it particularly relevant in sports nutrition. Additionally, it is involved in the regulation of blood sugar levels and the production of hemoglobin. The compound is generally considered safe for consumption, but like all amino acids, it should be used in moderation to avoid potential imbalances in amino acid levels. Overall, L-Isoleucine, ethyl ester, hydrochloride is valued for its functional properties in both health and nutrition contexts.
Formula:C8H17NO2·ClH
InChI:InChI=1S/C8H17NO2.ClH/c1-4-6(3)7(9)8(10)11-5-2;/h6-7H,4-5,9H2,1-3H3;1H/t6-,7-;/m0./s1
InChI key:InChIKey=QQGRWNMNWONMOO-LEUCUCNGSA-N
SMILES:[C@@H](C(OCC)=O)([C@H](CC)C)N.Cl
Synonyms:- <span class="text-smallcaps">L</span>-Isoleucine, ethyl ester, hydrochloride
- <span class="text-smallcaps">L</span>-Isoleucine, ethyl ester, hydrochloride (1:1)
- D-Isoleucine Ethyl Ester HCl
- Ethyl 2-amino-3-methylvalerate hydrochloride
- Ethyl <span class="text-smallcaps">L</span>-isoleucinate hydrochloride
- Isoleucine ethyl ester hydrochloride
- ethyl L-isoleucinate hydrochloride
- L-Isoleucine, ethyl ester, hydrochloride (1:1)
- L-Isoleucine, ethyl ester, hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
L-Isoleucine ethyl ester hydrochloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H18ClNO2Purity:98%Molecular weight:195.69L-Isoleucine Ethyl Ester Hydrochloride
CAS:Formula:C8H18ClNO2Purity:98%Color and Shape:SolidMolecular weight:195.6870Ethyl L-isoleucinate HCl
CAS:L-Isoleucine ethyl ester HCl is a bioactive chemical.
Formula:C8H18ClNO2Color and Shape:SolidMolecular weight:195.69Ethyl L-Isoleucinate Hydrochloride
CAS:Ethyl L-Isoleucinate HydrochloridePurity:98%Molecular weight:195.69g/molL-Isoleucine ethyl ester hydrochloride
CAS:L-Isoleucine ethyl ester hydrochloride is a human serum protein derivative that has been shown to inhibit tumor growth in vivo. It binds to the acidic crosslinker, which is a marker of tumor formation, and inhibits the polymerization of the target protein. L-Isoleucine ethyl ester hydrochloride has also been shown to be effective against cancer cells grown in vitro. L-Isoleucine ethyl ester hydrochloride is biodegradable and can be used as an anticancer agent.Formula:C8H17NO2·HClColor and Shape:White Off-White PowderMolecular weight:195.69 g/molL-Isoleucine ethyl ester hydrochloride
CAS:Formula:C8H18ClNO2Purity:95.0%Color and Shape:Solid, Crystalline PowderMolecular weight:195.69L-Isoleucine ethyl ester hydrochloride
CAS:L-Isoleucine ethyl ester hydrochloride is a versatile building block that can be used in the manufacture of research chemicals, reagents or speciality chemicals. It is a useful intermediate for the synthesis of complex compounds and a useful scaffold for the synthesis of other compounds. L-Isoleucine ethyl ester hydrochloride is not present in nature and has CAS No. 56782-52-6.Formula:C8H18ClNO2Molecular weight:195.69 g/molRef: 3D-J-521264
1kgTo inquire5kgTo inquire10kgTo inquire500gTo inquire2500gTo inquire-Unit-kgkgTo inquire





