
CAS 56784-39-5
:Ozolinone
Description:
Ozolinone, identified by its CAS number 56784-39-5, is a chemical compound that belongs to the class of heterocyclic compounds, specifically a type of oxazolidinone. It is characterized by a five-membered ring structure that includes both oxygen and nitrogen atoms. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocycles. Ozolinone may possess biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial agents. Its molecular structure allows for various functional group modifications, which can influence its reactivity and biological properties. Additionally, ozolinone derivatives may be explored for their potential applications in agrochemicals or as intermediates in organic synthesis. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or environmental impact. Overall, ozolinone represents a versatile compound with implications in both medicinal chemistry and industrial applications.
Formula:C11H16N2O3S
InChI:InChI=1/C11H16N2O3S/c1-12-8(7-9(14)15)17-11(10(12)16)13-5-3-2-4-6-13/h7,11H,2-6H2,1H3,(H,14,15)/b8-7-
InChI key:InChIKey=NQFBZYYUAFJYNS-FPLPWBNLNA-N
SMILES:O=C1C(S/C(=C\C(O)=O)/N1C)N2CCCCC2
Synonyms:- Ozolinone
- Acetic acid, [3-methyl-4-oxo-5-(1-piperidinyl)-2-thiazolidinylidene]-, (2Z)-
- Acetic acid, [3-methyl-4-oxo-5-(1-piperidinyl)-2-thiazolidinylidene]-, (Z)-
- (2Z)-2-[3-Methyl-4-oxo-5-(1-piperidinyl)-2-thiazolidinylidene]acetic acid
- Acetic acid, 2-[3-methyl-4-oxo-5-(1-piperidinyl)-2-thiazolidinylidene]-, (2Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ozolinone
CAS:<p>Ozolinone, an etozoline metabolite, is a loop diuretic treating hypertension and edema.</p>Formula:C11H16N2O3SColor and Shape:SolidMolecular weight:256.32
