CAS 5679-18-5
:ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate
Description:
Ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate, with the CAS number 5679-18-5, is an organic compound characterized by its pyrazole ring structure, which is substituted with a nitro group and two methyl groups. This compound typically appears as a yellow to orange solid or liquid, depending on its purity and specific conditions. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many pyrazole derivatives. The presence of the nitro group contributes to its potential reactivity and may influence its biological activity, making it of interest in various fields, including medicinal chemistry and agrochemicals. Ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate may exhibit properties such as being a potential intermediate in synthetic pathways or possessing specific pharmacological activities. As with many chemical substances, handling should be done with care, following appropriate safety protocols due to potential toxicity or reactivity.
Formula:C9H13N3O4
InChI:InChI=1/C9H13N3O4/c1-4-16-8(13)5-11-7(3)9(12(14)15)6(2)10-11/h4-5H2,1-3H3
SMILES:CCOC(=O)Cn1c(C)c(c(C)n1)N(=O)=O
Synonyms:- (3,5-Dimethyl-4-nitro-pyrazol-1-yl)-acetic acid ethyl ester
- 1H-Pyrazole-1-acetic acid, 3,5-dimethyl-4-nitro-, ethyl ester
- ethyl 2-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate
- Ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
