CAS 56797-01-4
:Hexanoic acid, 2-ethyl-, cerium(3+) salt (3:1)
Description:
Hexanoic acid, 2-ethyl-, cerium(3+) salt (3:1) is a coordination compound formed from cerium ions and 2-ethylhexanoic acid, a branched-chain fatty acid. This substance typically appears as a solid or viscous liquid and is characterized by its solubility in organic solvents while being less soluble in water due to its hydrophobic nature. The cerium(3+) ion imparts unique properties, including potential catalytic activity and stability in various chemical environments. The 3:1 ratio indicates that three molecules of 2-ethylhexanoic acid coordinate with one cerium ion, influencing the compound's overall structure and reactivity. This compound is often utilized in applications such as catalysis, materials science, and as a precursor in the synthesis of other cerium-based materials. Its properties can be affected by factors such as temperature and the presence of other ions or solvents. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C8H16O2Ce
InChI:InChI=1S/C8H16O2.Ce/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);
InChI key:InChIKey=LBMMCVVPEBMSDD-UHFFFAOYSA-N
SMILES:C(CCCC)(C(O)=O)CC.[Ce]
Synonyms:- Cerium 2-ethylhexanoate
- Cerium Hex-Cem
- Cerium tri(2-ethylhexanoate)
- Cerium tris(2-ethylhexanoate)
- CeriumethylhexanoateCecontains
- Cerous 2-ethylhexoate
- Hexanoic acid, 2-ethyl-, cerium(3+) salt
- Hexanoic acid, 2-ethyl-, cerium(3+) salt (3:1)
- Isooctanoate
- Cerium(III) 2-ethylhexanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cerium(III) 2-ethylhexanoate, 49% in 2-ethylhexanoic acid, Ce 12%
CAS:Used as catalyst, paint dryer, plastic Additive. As the the precursor in preparation of inorganic nanoparticles in oil-in-water microemulsions. The Toluene-based precursor solution was composed by mixing gadolinium (III) 2-ethylhexanoate and cerium (III) 2-ethylhexanoate to achieve the right stoichFormula:C24H45CeO6Color and Shape:Clear colorless to yellow, Viscous liquidMolecular weight:569.73Cerium(III) 2-ethylhexanoate, 49% in 2-ethylhexanoic acid (12% Ce)
CAS:Cerium(III) 2-ethylhexanoate, 49% in 2-ethylhexanoic acid (12% Ce)
Formula:CeOOCCH(C2H5)C4H9Color and Shape:viscous liq.Molecular weight:569.74

