CAS 568-72-9
:Tanshinone IIA
Description:
Tanshinone IIA is a bioactive compound primarily derived from the roots of the Salvia miltiorrhiza plant, commonly known as Danshen. It belongs to the class of compounds known as diterpenes and is characterized by its unique chemical structure, which includes a fused ring system. Tanshinone IIA exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, and cardioprotective effects. It has garnered attention in the field of medicinal chemistry for its potential therapeutic applications, particularly in cardiovascular diseases and cancer treatment. The compound is lipophilic, which influences its bioavailability and distribution in biological systems. Additionally, Tanshinone IIA has been shown to modulate various signaling pathways, contributing to its diverse biological activities. Its safety profile and efficacy are subjects of ongoing research, making it a significant focus in natural product chemistry and pharmacology. Overall, Tanshinone IIA represents a promising candidate for further investigation in drug development and therapeutic applications.
Formula:C19H18O3
InChI:InChI=1S/C19H18O3/c1-10-9-22-18-12-6-7-13-11(5-4-8-19(13,2)3)15(12)17(21)16(20)14(10)18/h6-7,9H,4-5,8H2,1-3H3
InChI key:InChIKey=HYXITZLLTYIPOF-UHFFFAOYSA-N
SMILES:O=C1C=2C(C3=C(C1=O)C(C)=CO3)=CC=C4C2CCCC4(C)C
Synonyms:- 1,6,6-Trimethyl-1,2,6,7,8,9-Hexahydrophenanthro[1,2-B]Furan-10,11-Dione
- 1,6,6-Trimethyl-6,7,8,9-Tetrahydrophenanthro[1,2-B]Furan-10,11-Dione
- 1,6,6-Trimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione
- 1,6-Dimethylphenanthro[1,2-B]Furan-10,11-Dione
- 6,7,8,9-Tetrahydro-1,6,6-trimethylphenanthro[1,2-b]furan-10,11-dione
- Dan Shen Ketone
- NSC 686519
- Nsc 686518
- Phenanthro(1,2-b)furan-10,11-dione, 6,7,8,9-tetrahydro-1,6,6-trimethyl-
- Salviol IIA
- Tanshinon II
- Tanshinone B
- Tanshinone II
- Tanshinone II A
- Tashinone IIA
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 15 products.
Tanshinone IIA
CAS:Formula:C19H18O3Purity:>97.0%(HPLC)Color and Shape:Orange to Brown powder to crystalMolecular weight:294.35Tanshinone II A
CAS:Tanshinone II A analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C19H18O3Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:294.35Tanshinone IIA
CAS:Other glycosides, natural or reproduced by synthesis, aFormula:C19H18O3Color and Shape:PowderMolecular weight:294.12559Phenanthro[1,2-b]furan-10,11-dione, 6,7,8,9-tetrahydro-1,6,6-trimethyl-
CAS:Formula:C19H18O3Purity:97%Color and Shape:SolidMolecular weight:294.3444Tanshinone IIA
CAS:Formula:C19H18O3Purity:≥ 97.0%Color and Shape:Orange to red or brown powderMolecular weight:294.34Tanshinone IIA
CAS:Tanshinone Ⅱ-A is a derivative of phenanthrenequinone isolated from Salvia miltiorrhiza BUNGE, a traditional herbal medicine that is known to induce anti-inflammatory, anti-oxidative and cytotoxic activity; tanshione Ⅱ-A induces HL60 and K562 cellular apoptosis that may be associated with the selective members of caspase familyFormula:C19H18O3Purity:95%~99%Color and Shape:Red powderMolecular weight:294.35Tanshinone IIA
CAS:Tanshinone IIA (Tanshinone B) is a natural diterpene quinone. Tanshinone IIA has anti-inflammatory, antioxidant activities. Cost-effective and quality-assured.Formula:C19H18O3Purity:99.04% - >99.99%Color and Shape:Cherry CrystalMolecular weight:294.34Tanshinone iia
CAS:Oxygen-heterocyclic compoundFormula:C19H18O3Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:294.351,6,6-Trimethyl-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione
CAS:1,6,6-Trimethyl-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione is a synthetic organic compound, which is typically derived through complex chemical synthesis involving multiple steps of organic reactions. This compound acts primarily as a ligand, often involved in binding studies due to its unique structural features that afford specific interactions with target biomolecules. Its mode of action primarily involves engaging in molecular binding through non-covalent interactions, which can be leveraged in biochemical assays to elucidate binding dynamics and affinity with proteins.Formula:C19H18O3Purity:Min. 95%Color and Shape:PowderMolecular weight:294.34 g/mol1,6,6-Trimethyl-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione
CAS:1,6,6-Trimethyl-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione is a sesquiterpenoid, which is a class of naturally occurring terpenes. This compound is typically derived from fungal sources, where it plays a role in the organism's secondary metabolism. Its mode of action involves the disruption of critical cellular processes in microbial organisms, primarily through interference with membrane function or inhibition of specific enzymatic pathways. The compound has garnered interest for its potential antimicrobial properties, providing an alternative approach to tackling resistant bacterial strains. Additionally, recent studies suggest its role as a bioactive compound with potential anticancer properties, wherein it may induce apoptosis or inhibit proliferation in certain cancer cell lines. These properties highlight the compound's significance in the development of novel pharmaceuticals and its potential application in therapeutic strategies against microbial infections and cancer.Formula:C19H18O3Purity:Min. 97.0 Area-%Molecular weight:294.34 g/molRef: 3D-Q-100654
1gTo inquire5gTo inquire10gTo inquire500mgTo inquire2500mgTo inquire-Unit-ggTo inquireTanshinone IIA-d6
CAS:Controlled ProductFormula:C19D6H12O3Color and Shape:NeatMolecular weight:300.381












