CAS 56812-60-3: magnesium bromide (2-bromophenyl)methanide

Description:Magnesium bromide (2-bromophenyl)methanide, with the CAS number 56812-60-3, is an organometallic compound that features a magnesium center coordinated to a bromide ion and a 2-bromophenylmethanide group. This compound typically exhibits characteristics common to organomagnesium compounds, such as high reactivity, particularly towards moisture and air, which can lead to hydrolysis and the formation of magnesium hydroxide and bromide. It is often used in organic synthesis as a reagent for various transformations, including nucleophilic substitutions and coupling reactions. The presence of the bromophenyl group can influence its reactivity and solubility in organic solvents. Additionally, magnesium bromide (2-bromophenyl)methanide may exhibit properties such as moderate thermal stability, but care must be taken during handling due to its potential reactivity. As with many organometallic compounds, it is essential to work under an inert atmosphere to prevent decomposition or unwanted reactions with atmospheric moisture or oxygen.

Formula:C₇H₆Br₂Mg

InChI:InChI=1/C7H6Br.BrH.Mg/c1-6-4-2-3-5-7(6)8;;/h2-5H,1H2;1H;/q-1;;+2/p-1